CAS 24332-98-7 appears in our catalog under these names: Methyl Beta-L-Fucopyranoside, 98%, 98%, Methyl beta-l-fucopyranoside, 98%, Methyl beta–L–fucopyranoside, Methyl b-L-fucopyranoside, Methyl b-L-fucopyranoside, 2 g. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Roth. Available pack sizes: 5g, 10g, 25g, 1g, 2g.
(2S,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol (CAS 24332-98-7) is a chemical compound with the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol. InChIKey: OHWCAVRRXKJCRB-XUVCUMPTSA-N.
| Molecular formula | C7H14O5 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-methoxy-6-methyloxane-3,4,5-triol |
| InChIKey | OHWCAVRRXKJCRB-XUVCUMPTSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OC)O)O)O |
Computed by PubChem (NCBI)