Products 1128085-54-0
CAS 1128085-54-0 is the registry number for H-L-Ala-D-Glu(OBzl)-NH2*Oxalate. Offered by: Iris Biotech. Available pack sizes: 5g, 25g, 100g.
Benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate (CAS 1128085-54-0) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate. InChIKey: FWRRPASOIACNMJ-CMPLNLGQSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | benzyl (4R)-5-amino-4-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoate |
| InChIKey | FWRRPASOIACNMJ-CMPLNLGQSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](CCC(=O)OCC1=CC=CC=C1)C(=O)N)N |
Computed by PubChem (NCBI)