Products 11281-65-5
CAS 11281-65-5 is the registry number for 3-Methoxy-2,4,5-trifluorobenzoic acid, 98%+,RG, 98%+,RG. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 500g.
2,4,5-trifluoro-3-methoxybenzoic acid (CAS 11281-65-5) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoic acid. InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoic acid |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2,4,5-Trifluoro-3-methoxybenzoic acid, 3-methoxy-2,4,5-trifluorobenzoic acid, 2,4,5-trifluoro-3-methoxy-benzoic Acid, 3-methoxy-2,4,5-triflourobenzoic acid, 3-methoxy-2,4,5-trifluoro-benzoic acid, 2,4,5-Trifluoro-3-methoxybenzoic acid, 95%, 2,4,5-tris(fluoranyl)-3-methoxy-benzoic acid, Moxidectin Impurity 5, Moxifloxacin Impurity 45, 2,4,5-trifluoro-3-methoxy benzoic acid