CAS 112918-82-8 appears in our catalog under these names: 2,2'–((((9H–Fluoren–9–yl)methoxy)carbonyl)azanediyl)diacetic acid, Fmoc-Ida-OH, Fmoc-iminodiacetic acid, Fmoc-Ida-OH, 98%, 98%, 2,2'-((((9H-Fluoren-9-yl)methoxy)carbonyl)azanediyl)diacetic acid, 99.90%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 25g, 10g, 50g, 100g, 1g, 25 g, 100 g.
2-[carboxymethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 112918-82-8) is a chemical compound with the molecular formula C19H17NO6 and a molecular weight of 355.3 g/mol. IUPAC name: 2-[carboxymethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: LNHILYINDTUUMZ-UHFFFAOYSA-N.
| Molecular formula | C19H17NO6 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | 2-[carboxymethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | LNHILYINDTUUMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)