Products 1352517-20-4

CAS 1352517-20-4 is the registry number for 1-Oxo-2-(3,4,5-trimethoxyphenyl)-1,2-dihydroisoquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-oxo-2-(3,4,5-trimethoxyphenyl)isoquinoline-4-carboxylic acid (CAS 1352517-20-4) is a chemical compound with the molecular formula C19H17NO6 and a molecular weight of 355.3 g/mol. IUPAC name: 1-oxo-2-(3,4,5-trimethoxyphenyl)isoquinoline-4-carboxylic acid. InChIKey: VOBNJHBEVPVOHM-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17NO6
Molecular weight355.3 g/mol
IUPAC name1-oxo-2-(3,4,5-trimethoxyphenyl)isoquinoline-4-carboxylic acid
InChIKeyVOBNJHBEVPVOHM-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)N2C=C(C3=CC=CC=C3C2=O)C(=O)O

Computed by PubChem (NCBI)