CAS 287484-33-7 is the registry number for (((9H-Fluoren-9-yl)methoxy)carbonyl)-L-aspartic acid-15N. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)butanedioic acid (CAS 287484-33-7) is a chemical compound with the molecular formula C19H17NO6 and a molecular weight of 356.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)butanedioic acid. InChIKey: KSDTXRUIZMTBNV-OICQNXLQSA-N.
| Molecular formula | C19H17NO6 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)butanedioic acid |
| InChIKey | KSDTXRUIZMTBNV-OICQNXLQSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH][C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)