CAS 136083-57-3 appears in our catalog under these names: N–((9H–Fluoren–9–ylmethoxy)carbonyl)–D–aspartic Acid, Fmoc–D–Asp–OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-aspartic Acid, >98.0%(HPLC)(T), Fmoc-D-Asp-OH 97%, Fmoc-D-Asp-OH, 97.82%. Offered by: GLPBio, TCI, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g, 100 g, 25 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioic acid (CAS 136083-57-3) is a chemical compound with the molecular formula C19H17NO6 and a molecular weight of 355.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioic acid. InChIKey: KSDTXRUIZMTBNV-MRXNPFEDSA-N.
| Molecular formula | C19H17NO6 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioic acid |
| InChIKey | KSDTXRUIZMTBNV-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)