Products 1130606-99-3
CAS 1130606-99-3 is the registry number for Di-tert-butyl (2S,3S)-3-hydroxypyrrolidine-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ditert-butyl (2S,3S)-3-hydroxypyrrolidine-1,2-dicarboxylate (CAS 1130606-99-3) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: ditert-butyl (2S,3S)-3-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: OFVBFMVRUUJRFC-UWVGGRQHSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ditert-butyl (2S,3S)-3-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | OFVBFMVRUUJRFC-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)