CAS 113100-55-3 is the registry number for 3-Methyl-1-(2,2,2-trifluoroethyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CAS 113100-55-3) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid. InChIKey: CHTJYARIOYPNAG-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 3-methyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| InChIKey | CHTJYARIOYPNAG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)