CAS 1131005-00-9 is the registry number for Desnitro Pretomanid. Offered by: TRC. Available pack sizes: 25mg.
(6S)-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (CAS 1131005-00-9) is a chemical compound with the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. IUPAC name: (6S)-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine. InChIKey: WUGKRGYZMYCMQS-LBPRGKRZSA-N.
| Molecular formula | C14H13F3N2O3 |
|---|---|
| Molecular weight | 314.26 g/mol |
| IUPAC name | (6S)-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| InChIKey | WUGKRGYZMYCMQS-LBPRGKRZSA-N |
| SMILES | C1[C@@H](COC2=NC=CN21)OCC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)