Products 1197579-69-3
CAS 1197579-69-3 is the registry number for 3-(1-Benzyl-1H-imidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-benzylimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanoic acid (CAS 1197579-69-3) is a chemical compound with the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. IUPAC name: 3-(1-benzylimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanoic acid. InChIKey: OPHSJZHBGVPCBO-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O3 |
|---|---|
| Molecular weight | 314.26 g/mol |
| IUPAC name | 3-(1-benzylimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutanoic acid |
| InChIKey | OPHSJZHBGVPCBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CN=C2C(CC(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)