CAS 1604-49-5 is the registry number for N-(2,2,2-Trifluoroacetyl)-L-tryptophan Methyl Ester. Offered by: TRC. Available pack sizes: 500mg.
Methyl (2S)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 1604-49-5) is a chemical compound with the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. IUPAC name: methyl (2S)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: FRCDVDBVNOWDDM-NSHDSACASA-N.
| Molecular formula | C14H13F3N2O3 |
|---|---|
| Molecular weight | 314.26 g/mol |
| IUPAC name | methyl (2S)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| InChIKey | FRCDVDBVNOWDDM-NSHDSACASA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)