CAS 1188911-77-4 appears in our catalog under these names: [5-(2,2,2-Trifluoro-1,1-dimethyl-ethyl)-isoxazol-3-yl]-carbamic acid phenyl ester, 95%, Phenyl (5-(1,1,1-trifluoro-2-methylpropan-2-yl)isoxazol-3-yl)carbamate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Phenyl N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]carbamate (CAS 1188911-77-4) is a chemical compound with the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. IUPAC name: phenyl N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]carbamate. InChIKey: KDJWLVDAZBRXOD-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O3 |
|---|---|
| Molecular weight | 314.26 g/mol |
| IUPAC name | phenyl N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]carbamate |
| InChIKey | KDJWLVDAZBRXOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=NO1)NC(=O)OC2=CC=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)