CAS 113118-84-6 appears in our catalog under these names: 5-Phenylnicotinaldehyde, 98%, 5–Phenylnicotinaldehyde, 3-Pyridinecarboxaldehyde, 5-phenyl-, ≥95%, ≥95%, 5-Phenylnicotinaldehyde, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
5-phenylpyridine-3-carbaldehyde (CAS 113118-84-6) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 5-phenylpyridine-3-carbaldehyde. InChIKey: ACFVOZGSDCHVGJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 5-phenylpyridine-3-carbaldehyde |
| InChIKey | ACFVOZGSDCHVGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=CC(=C2)C=O |
Computed by PubChem (NCBI)