Products 1131410-83-7

CAS 1131410-83-7 is the registry number for Ethyl N-((4-chloropyridin-2-yl)carbamothioyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl N-[(4-chloro-2-pyridinyl)carbamothioyl]carbamate (CAS 1131410-83-7) is a chemical compound with the molecular formula C9H10ClN3O2S and a molecular weight of 259.71 g/mol. IUPAC name: ethyl N-[(4-chloro-2-pyridinyl)carbamothioyl]carbamate. InChIKey: ZFHHOZNZAFCDBP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClN3O2S
Molecular weight259.71 g/mol
IUPAC nameethyl N-[(4-chloro-2-pyridinyl)carbamothioyl]carbamate
InChIKeyZFHHOZNZAFCDBP-UHFFFAOYSA-N
SMILESCCOC(=O)NC(=S)NC1=NC=CC(=C1)Cl

Computed by PubChem (NCBI)