CAS 1289384-70-8 appears in our catalog under these names: 1-(6-Chloro-2-methylsulfanyl-pyrimidin-4-yl)-azetidine-3-carboxylic acid, 95%, 1–(6–Chloro–2–(methylthio)pyrimidin–4–yl)azetidine–3–carboxylic acid, 1-(6-Chloro-2-(methylthio)pyrimidin-4-yl)azetidine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(6-chloro-2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid (CAS 1289384-70-8) is a chemical compound with the molecular formula C9H10ClN3O2S and a molecular weight of 259.71 g/mol. IUPAC name: 1-(6-chloro-2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid. InChIKey: JEMXWXHBKMKHBF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O2S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 1-(6-chloro-2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid |
| InChIKey | JEMXWXHBKMKHBF-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=CC(=N1)Cl)N2CC(C2)C(=O)O |
Computed by PubChem (NCBI)