CAS 1178711-74-4 appears in our catalog under these names: 2-Chloro-N,N-dimethylimidazo(1,2-a)pyridine-3-sulfonamide, 95%, 2-Chloro-N,N-dimethylimidazo(1,2-a)pyridine-3-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-chloro-N,N-dimethylimidazo[1,2-a]pyridine-3-sulfonamide (CAS 1178711-74-4) is a chemical compound with the molecular formula C9H10ClN3O2S and a molecular weight of 259.71 g/mol. IUPAC name: 2-chloro-N,N-dimethylimidazo[1,2-a]pyridine-3-sulfonamide. InChIKey: DIVWSRKQUAGGED-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O2S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 2-chloro-N,N-dimethylimidazo[1,2-a]pyridine-3-sulfonamide |
| InChIKey | DIVWSRKQUAGGED-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(N=C2N1C=CC=C2)Cl |
Computed by PubChem (NCBI)