CAS 20361-50-6 is the registry number for (S)-2-Amino-3-(benzo[c][1,2,5]thiadiazol-5-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-(2,1,3-benzothiadiazol-5-yl)propanoic acid;hydrochloride (CAS 20361-50-6) is a chemical compound with the molecular formula C9H10ClN3O2S and a molecular weight of 259.71 g/mol. IUPAC name: 2-amino-3-(2,1,3-benzothiadiazol-5-yl)propanoic acid;hydrochloride. InChIKey: JTKSUEWIBXVAAS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O2S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 2-amino-3-(2,1,3-benzothiadiazol-5-yl)propanoic acid;hydrochloride |
| InChIKey | JTKSUEWIBXVAAS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C=C1CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)