Products 1131622-55-3
CAS 1131622-55-3 is the registry number for 3-Bromo-4-(4-methylpiperazin-1-yl)benzoic acid, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 1131622-55-3) is a chemical compound with the molecular formula C12H15BrN2O2 and a molecular weight of 299.16 g/mol. IUPAC name: 3-bromo-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: USYGUVMUSGXQKK-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | 3-bromo-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | USYGUVMUSGXQKK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)