Products 113242-93-6
CAS 113242-93-6 appears in our catalog under these names: 3,3,3-Trifluoro-2-phenylpropan-1-ol, 95%, 3,3,3-Trifluoro-2-phenylpropan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3,3-trifluoro-2-phenylpropan-1-ol (CAS 113242-93-6) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 3,3,3-trifluoro-2-phenylpropan-1-ol. InChIKey: PDMIASFCGOSLLC-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-phenylpropan-1-ol |
| InChIKey | PDMIASFCGOSLLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CO)C(F)(F)F |
Computed by PubChem (NCBI)