Products 1132666-98-8
CAS 1132666-98-8 is the registry number for 4-Hydroxy-1-(3-pyridyl-2,4,5,6-d4)-1-butanone, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
4-hydroxy-1-(2,4,5,6-tetradeuterio-3-pyridinyl)butan-1-one (CAS 1132666-98-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 169.21 g/mol. IUPAC name: 4-hydroxy-1-(2,4,5,6-tetradeuterio-3-pyridinyl)butan-1-one. InChIKey: KTXUGZHJVRHQGP-DNZPNURCSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | 4-hydroxy-1-(2,4,5,6-tetradeuterio-3-pyridinyl)butan-1-one |
| InChIKey | KTXUGZHJVRHQGP-DNZPNURCSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)CCCO)[2H] |
Computed by PubChem (NCBI)