CAS 154603-21-1 is the registry number for 4-Hydroxy-1-(3-pyridyl)-1-butanone-4,4-d2. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4,4-dideuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one (CAS 154603-21-1) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 167.20 g/mol. IUPAC name: 4,4-dideuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one. InChIKey: KTXUGZHJVRHQGP-NCYHJHSESA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 167.20 g/mol |
| IUPAC name | 4,4-dideuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one |
| InChIKey | KTXUGZHJVRHQGP-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(CCC(=O)C1=CN=CC=C1)O |
Computed by PubChem (NCBI)