CAS 359435-75-9 appears in our catalog under these names: 4-Hydroxy-1-(3-pyridyl)-1-butanone (3,3,4,4-D4), >95% (HPLC), 4-Hydroxy-1-(pyridin-3-yl)butan-1-one-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
3,3,4,4-tetradeuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one (CAS 359435-75-9) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 169.21 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one. InChIKey: KTXUGZHJVRHQGP-QLYAIYELSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-4-hydroxy-1-pyridin-3-ylbutan-1-one |
| InChIKey | KTXUGZHJVRHQGP-QLYAIYELSA-N |
| SMILES | [2H]C([2H])(CC(=O)C1=CN=CC=C1)C([2H])([2H])O |
Computed by PubChem (NCBI)