CAS 1132787-68-8 appears in our catalog under these names: N-(3-Chlorophenylsulfonyl)-dl-leucine, 95%, N–((3–Chlorophenyl)sulfonyl)–L–leucine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-[(3-chlorophenyl)sulfonylamino]-4-methylpentanoic acid (CAS 1132787-68-8) is a chemical compound with the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. IUPAC name: 2-[(3-chlorophenyl)sulfonylamino]-4-methylpentanoic acid. InChIKey: KJQWUNLTCVDQQZ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO4S |
|---|---|
| Molecular weight | 305.78 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)sulfonylamino]-4-methylpentanoic acid |
| InChIKey | KJQWUNLTCVDQQZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NS(=O)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)