CAS 1858240-10-4 is the registry number for 2-[(3-Chloro-4-methylphenyl)(methylsulfonyl)amino]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-chloro-4-methyl-N-methylsulfonylanilino)butanoic acid (CAS 1858240-10-4) is a chemical compound with the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. IUPAC name: 2-(3-chloro-4-methyl-N-methylsulfonylanilino)butanoic acid. InChIKey: VOHLTBGDYYQCPC-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO4S |
|---|---|
| Molecular weight | 305.78 g/mol |
| IUPAC name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)butanoic acid |
| InChIKey | VOHLTBGDYYQCPC-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)N(C1=CC(=C(C=C1)C)Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)