Products 1858249-90-7

CAS 1858249-90-7 is the registry number for 4-[(5-Chloro-2-methylphenyl)(methylsulfonyl)amino]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoic acid (CAS 1858249-90-7) is a chemical compound with the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. IUPAC name: 4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoic acid. InChIKey: KYRPJFWQTLRGJN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO4S
Molecular weight305.78 g/mol
IUPAC name4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoic acid
InChIKeyKYRPJFWQTLRGJN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Cl)N(CCCC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)