CAS 1423024-80-9 appears in our catalog under these names: 2-(2,2-Dimethylpropanamido)-4-methoxybenzene-1-sulfonyl chloride, 95%, 2-(2,2-Dimethylpropanamido)-4-methoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,2-dimethylpropanoylamino)-4-methoxybenzenesulfonyl chloride (CAS 1423024-80-9) is a chemical compound with the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-4-methoxybenzenesulfonyl chloride. InChIKey: ZPANMRQWSLLKEL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO4S |
|---|---|
| Molecular weight | 305.78 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-4-methoxybenzenesulfonyl chloride |
| InChIKey | ZPANMRQWSLLKEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC(=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)