CAS 1132827-62-3 is the registry number for 3-(Benzo[d][1,3]dioxol-5-ylamino)-4-methoxycyclobut-3-ene-1,2-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,3-benzodioxol-5-ylamino)-4-methoxycyclobut-3-ene-1,2-dione (CAS 1132827-62-3) is a chemical compound with the molecular formula C12H9NO5 and a molecular weight of 247.20 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-ylamino)-4-methoxycyclobut-3-ene-1,2-dione. InChIKey: IJSHNLQYMQZAQF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5 |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-ylamino)-4-methoxycyclobut-3-ene-1,2-dione |
| InChIKey | IJSHNLQYMQZAQF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=O)C1=O)NC2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)