Products 763109-72-4

CAS 763109-72-4 is the registry number for 5-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)isoxazole-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazole-3-carboxylic acid (CAS 763109-72-4) is a chemical compound with the molecular formula C12H9NO5 and a molecular weight of 247.20 g/mol. IUPAC name: 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: IKVSBAJCNQWULH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO5
Molecular weight247.20 g/mol
IUPAC name5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-oxazole-3-carboxylic acid
InChIKeyIKVSBAJCNQWULH-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)C3=CC(=NO3)C(=O)O

Computed by PubChem (NCBI)