CAS 1218777-30-0 appears in our catalog under these names: Rivaroxaban Impurity 103, 2-((2-Oxo-1,3-dioxolan-4-yl)methyl)-1H-isoindole-1,3(2H)-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-[(2-oxo-1,3-dioxolan-4-yl)methyl]isoindole-1,3-dione (CAS 1218777-30-0) is a chemical compound with the molecular formula C12H9NO5 and a molecular weight of 247.20 g/mol. IUPAC name: 2-[(2-oxo-1,3-dioxolan-4-yl)methyl]isoindole-1,3-dione. InChIKey: SAKALUVUEFQHMT-UHFFFAOYSA-N.
| Molecular formula | C12H9NO5 |
|---|---|
| Molecular weight | 247.20 g/mol |
| IUPAC name | 2-[(2-oxo-1,3-dioxolan-4-yl)methyl]isoindole-1,3-dione |
| InChIKey | SAKALUVUEFQHMT-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)O1)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)