Products 1133-45-5
CAS 1133-45-5 is the registry number for 2,3-Di-O-methyl-D-glucopyranose. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
(3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-dimethoxyoxane-2,5-diol (CAS 1133-45-5) is a chemical compound with the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. IUPAC name: (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-dimethoxyoxane-2,5-diol. InChIKey: SQYIWHJCOMWKNU-KEWYIRBNSA-N.
| Molecular formula | C8H16O6 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (3R,4S,5R,6R)-6-(hydroxymethyl)-3,4-dimethoxyoxane-2,5-diol |
| InChIKey | SQYIWHJCOMWKNU-KEWYIRBNSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](OC([C@@H]1OC)O)CO)O |
Computed by PubChem (NCBI)