CAS 19887-43-5 is the registry number for 2,4-Di-O-methyl-D-glucose. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(2R,3S,4R,5R)-3,5,6-trihydroxy-2,4-dimethoxyhexanal (CAS 19887-43-5) is a chemical compound with the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. IUPAC name: (2R,3S,4R,5R)-3,5,6-trihydroxy-2,4-dimethoxyhexanal. InChIKey: UITMJPZVJJKFBV-ULAWRXDQSA-N.
| Molecular formula | C8H16O6 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2R,3S,4R,5R)-3,5,6-trihydroxy-2,4-dimethoxyhexanal |
| InChIKey | UITMJPZVJJKFBV-ULAWRXDQSA-N |
| SMILES | CO[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)OC)O |
Computed by PubChem (NCBI)