CAS 1820-84-4 appears in our catalog under these names: Ethyl β–D–fructofuranoside, Ethyl b-D-fructofuranoside, Ethyl beta-D-Fructofuranoside, Ethyl β-fructofuranoside. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 20mg, Get quote.
(2R,3S,4S,5R)-2-ethoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 1820-84-4) is a chemical compound with the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. IUPAC name: (2R,3S,4S,5R)-2-ethoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: KQQFKZUGBOQKLW-OOJXKGFFSA-N.
| Molecular formula | C8H16O6 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-ethoxy-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | KQQFKZUGBOQKLW-OOJXKGFFSA-N |
| SMILES | CCO[C@]1([C@H]([C@@H]([C@H](O1)CO)O)O)CO |
Computed by PubChem (NCBI)