CAS 27551-99-1 is the registry number for Methyl 4-O-methyl-α-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol (CAS 27551-99-1) is a chemical compound with the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. IUPAC name: (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol. InChIKey: YEEFEWNECFNTEE-PVFLNQBWSA-N.
| Molecular formula | C8H16O6 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-2,5-dimethoxyoxane-3,4-diol |
| InChIKey | YEEFEWNECFNTEE-PVFLNQBWSA-N |
| SMILES | CO[C@@H]1[C@H](O[C@@H]([C@@H]([C@H]1O)O)OC)CO |
Computed by PubChem (NCBI)