CAS 1133082-92-4 appears in our catalog under these names: 2-Chloro-6-(3,5-dimethyl-1H-pyrazol-1-yl)pyrazine, 95%, 2-Chloro-6-(3,5-dimethyl-1H-pyrazol-1-yl)pyrazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrazine (CAS 1133082-92-4) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 2-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrazine. InChIKey: AKLLGGYKLKOWRX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 2-chloro-6-(3,5-dimethylpyrazol-1-yl)pyrazine |
| InChIKey | AKLLGGYKLKOWRX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CN=CC(=N2)Cl)C |
Computed by PubChem (NCBI)