Products 1133210-23-7
CAS 1133210-23-7 appears in our catalog under these names: (R)-Cetirizine-d4 Dihydrochloride, >95% (HPLC), (R)-Cetirizine-d4 dihydrochloride, Levocetirizine-d4, 99.41%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid (CAS 1133210-23-7) is a chemical compound with the molecular formula C21H25ClN2O3 and a molecular weight of 392.9 g/mol. IUPAC name: 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid. InChIKey: ZKLPARSLTMPFCP-KNFDVUFYSA-N.
| Molecular formula | C21H25ClN2O3 |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid |
| InChIKey | ZKLPARSLTMPFCP-KNFDVUFYSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OCC(=O)O)N1CCN(CC1)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)