Products 1219803-84-5
CAS 1219803-84-5 appears in our catalog under these names: Cetirizine-D4, (±)-Cetirizine-d4 (ethoxy-d4), 99 atom % D, min 98% Chemical Purity, Cetirizine D4, Cetirizine D4, Cetirizine-d4, 99.1%. Offered by: Chemat Brand, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 1mg, 5mg, 10mg, 10 mg, 5 mg.
2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid (CAS 1219803-84-5) is a chemical compound with the molecular formula C21H25ClN2O3 and a molecular weight of 392.9 g/mol. IUPAC name: 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid. InChIKey: ZKLPARSLTMPFCP-QZPARXMSSA-N.
| Molecular formula | C21H25ClN2O3 |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1,1,2,2-tetradeuterioethoxy]acetic acid |
| InChIKey | ZKLPARSLTMPFCP-QZPARXMSSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OCC(=O)O)N1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)