Products 774596-22-4
CAS 774596-22-4 appears in our catalog under these names: Cetirizine-D8, Cetirizine D8, Cetirizine D8, Cetirizine-d8, 98.37%, 98.37%, Cetirizine-d8, 96.46%. Offered by: Chemat Brand, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 1 mg, 5 mg, 10 mg.
2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]acetic acid (CAS 774596-22-4) is a chemical compound with the molecular formula C21H25ClN2O3 and a molecular weight of 396.9 g/mol. IUPAC name: 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]acetic acid. InChIKey: ZKLPARSLTMPFCP-BGKXKQMNSA-N.
| Molecular formula | C21H25ClN2O3 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]acetic acid |
| InChIKey | ZKLPARSLTMPFCP-BGKXKQMNSA-N |
| SMILES | [2H]C1(C(N(C(C(N1CCOCC(=O)O)([2H])[2H])([2H])[2H])C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)