CAS 1232460-29-5 appears in our catalog under these names: Cetirizine 3-Chloro Impurity DiHCl, Cetirizine Impurity 26, Cetirizine 3-Chloro Impurity Dihydrochloride, >95% (HPLC), 3-Chlorocetirizine Dihydrochloride ((RS)-2-(2-(4-((3-Chlorophenyl)phenylmethyl)piperazin-1-yl)ethoxy)acetic Acid Dihydrochloride), Cetirizine 3-chloro impurity dihydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2mg.
2-[2-[4-[(3-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid (CAS 1232460-29-5) is a chemical compound with the molecular formula C21H25ClN2O3 and a molecular weight of 388.9 g/mol. IUPAC name: 2-[2-[4-[(3-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid. InChIKey: KIDBOSZFDKRHNX-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O3 |
|---|---|
| Molecular weight | 388.9 g/mol |
| IUPAC name | 2-[2-[4-[(3-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| InChIKey | KIDBOSZFDKRHNX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)