Products 1133229-29-4
CAS 1133229-29-4 appears in our catalog under these names: Levetiracetam-d6, Levetiracetam-d6 (2,3,3,4,4,4-butyramide-d6), 97 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 0,01g, 0,005g, 1 mg, 2.5 mg.
(2S)-2,3,3,4,4,4-hexadeuterio-2-(2-oxopyrrolidin-1-yl)butanamide (CAS 1133229-29-4) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 176.25 g/mol. IUPAC name: (2S)-2,3,3,4,4,4-hexadeuterio-2-(2-oxopyrrolidin-1-yl)butanamide. InChIKey: HPHUVLMMVZITSG-QCIDAUEHSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | (2S)-2,3,3,4,4,4-hexadeuterio-2-(2-oxopyrrolidin-1-yl)butanamide |
| InChIKey | HPHUVLMMVZITSG-QCIDAUEHSA-N |
| SMILES | [2H][C@@](C(=O)N)(C([2H])([2H])C([2H])([2H])[2H])N1CCCC1=O |
Computed by PubChem (NCBI)