CAS 1133229-30-7 appears in our catalog under these names: Levetiracetam-d6, Levetiracetam-d6, >95% (HPLC), Levetiracetam–d6, Levetiracetam-d6 (ring-d6), 99.33%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 1 mg, 5 mg.
(2S)-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)butanamide (CAS 1133229-30-7) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 176.25 g/mol. IUPAC name: (2S)-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)butanamide. InChIKey: HPHUVLMMVZITSG-QXMLZOKMSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | (2S)-2-(2,2,3,3,4,4-hexadeuterio-5-oxopyrrolidin-1-yl)butanamide |
| InChIKey | HPHUVLMMVZITSG-QXMLZOKMSA-N |
| SMILES | [2H]C1(C(=O)N(C(C1([2H])[2H])([2H])[2H])[C@@H](CC)C(=O)N)[2H] |
Computed by PubChem (NCBI)