CAS 2714408-84-9 appears in our catalog under these names: Etiracetam-d3, D3-Etiracetam, D3-Etiracetam, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 5mg, 1mg, 1x5mg, 1x1ml.
4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide (CAS 2714408-84-9) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 173.23 g/mol. IUPAC name: 4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide. InChIKey: HPHUVLMMVZITSG-FIBGUPNXSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | 4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide |
| InChIKey | HPHUVLMMVZITSG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C(=O)N)N1CCCC1=O |
Computed by PubChem (NCBI)