Products 1217851-16-5
CAS 1217851-16-5 appears in our catalog under these names: Levetiracetam-d3, >95% (GC), Levetiracetam-d3 (contains d0), >95% (HPLC), Levetiracetam-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 5mg, 2mg, 10 mg, 1 mg.
(2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide (CAS 1217851-16-5) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 173.23 g/mol. IUPAC name: (2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide. InChIKey: HPHUVLMMVZITSG-FYFSCIFKSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | (2S)-4,4,4-trideuterio-2-(2-oxopyrrolidin-1-yl)butanamide |
| InChIKey | HPHUVLMMVZITSG-FYFSCIFKSA-N |
| SMILES | [2H]C([2H])([2H])C[C@@H](C(=O)N)N1CCCC1=O |
Computed by PubChem (NCBI)