Products 1133314-10-9
CAS 1133314-10-9 is the registry number for Methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate (CAS 1133314-10-9) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate. InChIKey: PXJBDEOGQHZJJU-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate |
| InChIKey | PXJBDEOGQHZJJU-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=C(C=C(C=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)