Products 423753-00-8
CAS 423753-00-8 is the registry number for (2E)-3-(2-Bromo-4-ethoxy-5-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(2-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoic acid (CAS 423753-00-8) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: (E)-3-(2-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoic acid. InChIKey: NCTZWQDMSMBMPI-SNAWJCMRSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | (E)-3-(2-bromo-4-ethoxy-5-methoxyphenyl)prop-2-enoic acid |
| InChIKey | NCTZWQDMSMBMPI-SNAWJCMRSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)Br)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)