CAS 728022-29-5 is the registry number for 3-Bromo-5-(tert-butoxycarbonyl)benzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-5-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid (CAS 728022-29-5) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: 3-bromo-5-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid. InChIKey: FHOSJGNGFCKDBZ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 3-bromo-5-[(2-methylpropan-2-yl)oxycarbonyl]benzoic acid |
| InChIKey | FHOSJGNGFCKDBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)