Products 127437-29-0
CAS 127437-29-0 appears in our catalog under these names: Diethyl 5–Bromoisophthalate, Diethyl 5-bromoisophthalate 97%, DIETHYL 5-BROMOISOPHTHALATE, 97%, 97%, Diethyl 5-bromoisophthalate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 100g.
Diethyl 5-bromobenzene-1,3-dicarboxylate (CAS 127437-29-0) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: diethyl 5-bromobenzene-1,3-dicarboxylate. InChIKey: ZDFHATYWKREQJF-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO4 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | diethyl 5-bromobenzene-1,3-dicarboxylate |
| InChIKey | ZDFHATYWKREQJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Br)C(=O)OCC |
Computed by PubChem (NCBI)