Products 113334-60-4
CAS 113334-60-4 is the registry number for Ethyl 2-(4-hydroxyphenyl)thiazole-4-carboxylate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg.
Ethyl 2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate (CAS 113334-60-4) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: ethyl 2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate. InChIKey: ZKQDDUPBNHWQGO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | ethyl 2-(4-hydroxyphenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | ZKQDDUPBNHWQGO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)