Products 1133725-45-7

CAS 1133725-45-7 is the registry number for Methyl 3-{((2-hydroxyphenoxy)sulfonyl)amino}propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-[(2-hydroxyphenoxy)sulfonylamino]propanoate (CAS 1133725-45-7) is a chemical compound with the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. IUPAC name: methyl 3-[(2-hydroxyphenoxy)sulfonylamino]propanoate. InChIKey: GYKYERZJFHKSIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO6S
Molecular weight275.28 g/mol
IUPAC namemethyl 3-[(2-hydroxyphenoxy)sulfonylamino]propanoate
InChIKeyGYKYERZJFHKSIJ-UHFFFAOYSA-N
SMILESCOC(=O)CCNS(=O)(=O)OC1=CC=CC=C1O

Computed by PubChem (NCBI)