Products 66644-82-4
CAS 66644-82-4 is the registry number for Methyl 2,3-dimethoxy-5-sulphamoylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2,3-dimethoxy-5-sulfamoylbenzoate (CAS 66644-82-4) is a chemical compound with the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. IUPAC name: methyl 2,3-dimethoxy-5-sulfamoylbenzoate. InChIKey: LLPQAUJOSNFUSU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6S |
|---|---|
| Molecular weight | 275.28 g/mol |
| IUPAC name | methyl 2,3-dimethoxy-5-sulfamoylbenzoate |
| InChIKey | LLPQAUJOSNFUSU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)